Difference between revisions of "CPD-7214"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16156 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3PGAREARR-RXN ** Categ...") |
(Created page with "Category:metabolite == Metabolite CPD-7214 == * common-name: ** (2s)-dihydrotricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-7214 == |
− | + | * common-name: | |
− | * | + | ** (2s)-dihydrotricetin |
− | + | * smiles: | |
− | + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) | |
− | * | + | * inchi-key: |
− | ** | + | ** usqxpewrywrrjd-lbprgkrzsa-m |
− | + | * molecular-weight: | |
− | == | + | ** 303.248 |
− | + | == Reaction(s) known to consume the compound == | |
− | * | + | * [[RXN-7922]] |
− | ** | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=(2s)-dihydrotricetin}} | |
− | + | {{#set: inchi-key=inchikey=usqxpewrywrrjd-lbprgkrzsa-m}} | |
− | + | {{#set: molecular-weight=303.248}} | |
− | |||
− | |||
− | * | ||
− | ** | ||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-7214
- common-name:
- (2s)-dihydrotricetin
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
- inchi-key:
- usqxpewrywrrjd-lbprgkrzsa-m
- molecular-weight:
- 303.248