Difference between revisions of "CPD-7214"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIAMINONONANOATE == * common-name: ** 7,8-diaminopelargonate * smiles: ** cc(c(cccccc([o-])=o)[n+])[n+] * inchi-key: ** kcegbpiygiwcdh-uh...") |
(Created page with "Category:metabolite == Metabolite CPD-7214 == * common-name: ** (2s)-dihydrotricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7214 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s)-dihydrotricetin |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** usqxpewrywrrjd-lbprgkrzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 303.248 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7922]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s)-dihydrotricetin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=usqxpewrywrrjd-lbprgkrzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=303.248}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-7214
- common-name:
- (2s)-dihydrotricetin
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
- inchi-key:
- usqxpewrywrrjd-lbprgkrzsa-m
- molecular-weight:
- 303.248
