Difference between revisions of "CPD-7214"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DNA-with-mismatch == * common-name: ** a dna containing a mismatch == Reaction(s) known to consume the compound == * RXN-11049 == Rea...")
(Created page with "Category:metabolite == Metabolite CPD-7214 == * common-name: ** (2s)-dihydrotricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DNA-with-mismatch ==
+
== Metabolite CPD-7214 ==
 
* common-name:
 
* common-name:
** a dna containing a mismatch
+
** (2s)-dihydrotricetin
 +
* smiles:
 +
** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
 +
* inchi-key:
 +
** usqxpewrywrrjd-lbprgkrzsa-m
 +
* molecular-weight:
 +
** 303.248
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11049]]
+
* [[RXN-7922]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a dna containing a mismatch}}
+
{{#set: common-name=(2s)-dihydrotricetin}}
 +
{{#set: inchi-key=inchikey=usqxpewrywrrjd-lbprgkrzsa-m}}
 +
{{#set: molecular-weight=303.248}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-7214

  • common-name:
    • (2s)-dihydrotricetin
  • smiles:
    • c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
  • inchi-key:
    • usqxpewrywrrjd-lbprgkrzsa-m
  • molecular-weight:
    • 303.248

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality