Difference between revisions of "CPD-7221"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-369 == * common-name: ** l-iditol * smiles: ** c(c(c(c(c(o)co)o)o)o)o * inchi-key: ** fbpfztcfmrresa-untfvmjosa-n * molecular-weight:...")
(Created page with "Category:metabolite == Metabolite CPD-7221 == * common-name: ** (3z)-dodec-3-enoyl-coa * smiles: ** ccccccccc=ccc(sccnc(ccnc(c(c(cop(op(occ3(c(op(=o)([o-])[o-])c(o)c(n2(c1...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-369 ==
+
== Metabolite CPD-7221 ==
 
* common-name:
 
* common-name:
** l-iditol
+
** (3z)-dodec-3-enoyl-coa
 
* smiles:
 
* smiles:
** c(c(c(c(c(o)co)o)o)o)o
+
** ccccccccc=ccc(sccnc(ccnc(c(c(cop(op(occ3(c(op(=o)([o-])[o-])c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))(=o)[o-])(=o)[o-])(c)c)o)=o)=o)=o
 
* inchi-key:
 
* inchi-key:
** fbpfztcfmrresa-untfvmjosa-n
+
** xemivmktvgrftd-qxmhvhedsa-j
 
* molecular-weight:
 
* molecular-weight:
** 182.173
+
** 943.792
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
* [[RXN-7931]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
* [[RXN-14394]]
 +
* [[RXN-7931]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-iditol}}
+
{{#set: common-name=(3z)-dodec-3-enoyl-coa}}
{{#set: inchi-key=inchikey=fbpfztcfmrresa-untfvmjosa-n}}
+
{{#set: inchi-key=inchikey=xemivmktvgrftd-qxmhvhedsa-j}}
{{#set: molecular-weight=182.173}}
+
{{#set: molecular-weight=943.792}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-7221

  • common-name:
    • (3z)-dodec-3-enoyl-coa
  • smiles:
    • ccccccccc=ccc(sccnc(ccnc(c(c(cop(op(occ3(c(op(=o)([o-])[o-])c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))(=o)[o-])(=o)[o-])(c)c)o)=o)=o)=o
  • inchi-key:
    • xemivmktvgrftd-qxmhvhedsa-j
  • molecular-weight:
    • 943.792

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality