Difference between revisions of "CPD-7222"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15564 RXN-15564] == * direction: ** left-to-right * common-name: ** n-terminal e2 ubiquitin-con...")
 
(Created page with "Category:metabolite == Metabolite CPD-7222 == * common-name: ** (2e)-dodec-2-enoyl-coa * smiles: ** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15564 RXN-15564] ==
+
== Metabolite CPD-7222 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** n-terminal e2 ubiquitin-conjugating enzyme
+
** (2e)-dodec-2-enoyl-coa
−
== Reaction formula ==
+
* smiles:
−
* 1 [[N-terminal-Amino-Acids]][c] '''+''' 1 [[S-ubi-N-term-specific-UCP-E2-L-cysteine]][c] '''=>''' 1 [[N-terminal-specific-UCP-E2-L-cysteine]][c] '''+''' 1 [[N-terminal-ubiquitinyl-proteins]][c] '''+''' 1 [[PROTON]][c]
+
** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ20124]]
+
** irfyvbulxzmede-xcfippspsa-j
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 943.792
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
* [[PWY-7511]], protein ubiquitination: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511]
+
* [[ECOAH5]]
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
* [[ECOAH5h]]
−
== Reconstruction information  ==
+
* [[ECOAH5m]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14262]]
−
== External links  ==
+
* [[RXN-7931]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: common-name=n-terminal e2 ubiquitin-conjugating enzyme}}
+
* [[ACOA120OR]]
−
{{#set: nb gene associated=1}}
+
* [[ECOAH5]]
−
{{#set: nb pathway associated=1}}
+
* [[ECOAH5h]]
−
{{#set: reconstruction category=annotation}}
+
* [[ECOAH5m]]
−
{{#set: reconstruction tool=pathwaytools}}
+
* [[RXN-14262]]
−
{{#set: reconstruction comment=n.a}}
+
* [[RXN-7931]]
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=(2e)-dodec-2-enoyl-coa}}
 +
{{#set: inchi-key=inchikey=irfyvbulxzmede-xcfippspsa-j}}
 +
{{#set: molecular-weight=943.792}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-7222

  • common-name:
    • (2e)-dodec-2-enoyl-coa
  • smiles:
    • cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
  • inchi-key:
    • irfyvbulxzmede-xcfippspsa-j
  • molecular-weight:
    • 943.792

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7222&oldid=139125"