Difference between revisions of "CPD-7222"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HDAO10x HDAO10x] == * direction: ** left-to-right * common-name: ** (s)-2-hydroxy-acid oxidase == R...") |
(Created page with "Category:metabolite == Metabolite CPD-7222 == * common-name: ** (2e)-dodec-2-enoyl-coa * smiles: ** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7222 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** ( | + | ** (2e)-dodec-2-enoyl-coa |
| − | == | + | * smiles: |
| − | + | ** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o | |
| − | == | + | * inchi-key: |
| − | * | + | ** irfyvbulxzmede-xcfippspsa-j |
| − | ** | + | * molecular-weight: |
| − | * | + | ** 943.792 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[ECOAH5]] | |
| − | * | + | * [[ECOAH5h]] |
| − | == | + | * [[ECOAH5m]] |
| − | + | * [[RXN-14262]] | |
| − | {{#set: common-name=( | + | * [[RXN-7931]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ACOA120OR]] | |
| − | {{#set: | + | * [[ECOAH5]] |
| − | + | * [[ECOAH5h]] | |
| − | + | * [[ECOAH5m]] | |
| − | + | * [[RXN-14262]] | |
| + | * [[RXN-7931]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=(2e)-dodec-2-enoyl-coa}} | ||
| + | {{#set: inchi-key=inchikey=irfyvbulxzmede-xcfippspsa-j}} | ||
| + | {{#set: molecular-weight=943.792}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-7222
- common-name:
- (2e)-dodec-2-enoyl-coa
- smiles:
- cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
- inchi-key:
- irfyvbulxzmede-xcfippspsa-j
- molecular-weight:
- 943.792
