|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6PGLUCONOLACT-RXN 6PGLUCONOLACT-RXN] == | + | == Metabolite CPD-7224 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 6-phosphogluconolactonase | + | ** n-acetyl-l-citrulline |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.1.1.31 ec-3.1.1.31] | + | ** cc(=o)nc(c([o-])=o)cccnc(=o)n |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[D-6-P-GLUCONO-DELTA-LACTONE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-2961]][c] '''+''' 1 [[PROTON]][c]
| + | ** wmqmioyqxnrroc-lurjtmiesa-m |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ07027]] | + | ** 216.216 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-7933]] |
| − | * Gene: [[SJ10585]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | {{#set: common-name=n-acetyl-l-citrulline}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=wmqmioyqxnrroc-lurjtmiesa-m}} |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: molecular-weight=216.216}} |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[GLYCOLYSIS-E-D]], superpathway of glycolysis and the Entner-Doudoroff pathway: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS-E-D GLYCOLYSIS-E-D] | |
| − | ** '''4''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[OXIDATIVEPENT-PWY]], pentose phosphate pathway (oxidative branch) I: [http://metacyc.org/META/NEW-IMAGE?object=OXIDATIVEPENT-PWY OXIDATIVEPENT-PWY]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[RUMP-PWY]], formaldehyde oxidation I: [http://metacyc.org/META/NEW-IMAGE?object=RUMP-PWY RUMP-PWY]
| |
| − | ** '''4''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
| |
| − | ** '''16''' reactions found over '''18''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12557 12557]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02035 R02035]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P63337 P63337]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=6-phosphogluconolactonase}} | |
| − | {{#set: ec-number=ec-3.1.1.31}}
| |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=4}}
| |
| − | {{#set: reconstruction category=annotation|orthology}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
| |
