Difference between revisions of "CPD-7224"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...")
(Created page with "Category:metabolite == Metabolite CPD-7224 == * common-name: ** n-acetyl-l-citrulline * smiles: ** cc(=o)nc(c([o-])=o)cccnc(=o)n * inchi-key: ** wmqmioyqxnrroc-lurjtmiesa-...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FRUCTOSE-6P ==
+
== Metabolite CPD-7224 ==
 
* common-name:
 
* common-name:
** β-d-fructofuranose 6-phosphate
+
** n-acetyl-l-citrulline
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
+
** cc(=o)nc(c([o-])=o)cccnc(=o)n
 
* inchi-key:
 
* inchi-key:
** bgwgxpapygqalx-arqdhwqxsa-l
+
** wmqmioyqxnrroc-lurjtmiesa-m
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 216.216
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.90-RXN]]
+
* [[RXN-7933]]
* [[2TRANSKETO-RXN]]
 
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 
* [[6PFRUCTPHOS-RXN]]
 
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 
* [[MANNPDEHYDROG-RXN]]
 
* [[MANNPISOM-RXN]]
 
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 
* [[PFK_]]
 
* [[PGIA]]
 
* [[PGIAh]]
 
* [[PGIB]]
 
* [[PGIBh]]
 
* [[PGLUCISOM-RXN]]
 
* [[RXN-14812]]
 
* [[TRANSALDOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.90-RXN]]
 
* [[2TRANSKETO-RXN]]
 
* [[3.1.3.46-RXN]]
 
* [[F16BDEPHOS-RXN]]
 
* [[FRUCTOKINASE-RXN]]
 
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 
* [[MANNPDEHYDROG-RXN]]
 
* [[MANNPISOM-RXN]]
 
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 
* [[PGIA]]
 
* [[PGIAh]]
 
* [[PGIB]]
 
* [[PGIBh]]
 
* [[PGLUCISOM-RXN]]
 
* [[RXN-14812]]
 
* [[TRANSALDOL-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructofuranose 6-phosphate}}
+
{{#set: common-name=n-acetyl-l-citrulline}}
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
+
{{#set: inchi-key=inchikey=wmqmioyqxnrroc-lurjtmiesa-m}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=216.216}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-7224

  • common-name:
    • n-acetyl-l-citrulline
  • smiles:
    • cc(=o)nc(c([o-])=o)cccnc(=o)n
  • inchi-key:
    • wmqmioyqxnrroc-lurjtmiesa-m
  • molecular-weight:
    • 216.216

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality