Difference between revisions of "CPD-7243"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYGLUTARATE == * common-name: ** (r)-2-hydroxyglutarate * smiles: ** c(ccc(c([o-])=o)o)([o-])=o * inchi-key: ** hwxbtnavrsuojr-g...")
(Created page with "Category:metabolite == Metabolite CPD-7243 == * common-name: ** (24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa * smiles: ** cc(ccc=c(c)c(sccnc(=...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite R-2-HYDROXYGLUTARATE ==
+
== Metabolite CPD-7243 ==
 
* common-name:
 
* common-name:
** (r)-2-hydroxyglutarate
+
** (24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa
 
* smiles:
 
* smiles:
** c(ccc(c([o-])=o)o)([o-])=o
+
** cc(ccc=c(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4c(o)c[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7))))
 
* inchi-key:
 
* inchi-key:
** hwxbtnavrsuojr-gsvougtgsa-l
+
** qvdpwqvoskjues-jmoyvibvsa-j
 
* molecular-weight:
 
* molecular-weight:
** 146.099
+
** 1194.129
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[KETOGLUTREDUCT-RXN]]
+
* [[4.2.1.107-RXN]]
* [[RXN-14932]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[KETOGLUTREDUCT-RXN]]
+
* [[4.2.1.107-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-2-hydroxyglutarate}}
+
{{#set: common-name=(24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa}}
{{#set: inchi-key=inchikey=hwxbtnavrsuojr-gsvougtgsa-l}}
+
{{#set: inchi-key=inchikey=qvdpwqvoskjues-jmoyvibvsa-j}}
{{#set: molecular-weight=146.099}}
+
{{#set: molecular-weight=1194.129}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-7243

  • common-name:
    • (24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa
  • smiles:
    • cc(ccc=c(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4c(o)c[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7))))
  • inchi-key:
    • qvdpwqvoskjues-jmoyvibvsa-j
  • molecular-weight:
    • 1194.129

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality