Difference between revisions of "CPD-7243"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYGLUTARATE == * common-name: ** (r)-2-hydroxyglutarate * smiles: ** c(ccc(c([o-])=o)o)([o-])=o * inchi-key: ** hwxbtnavrsuojr-g...") |
(Created page with "Category:metabolite == Metabolite CPD-7243 == * common-name: ** (24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa * smiles: ** cc(ccc=c(c)c(sccnc(=...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7243 == |
* common-name: | * common-name: | ||
− | ** ( | + | ** (24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(ccc=c(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4c(o)c[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qvdpwqvoskjues-jmoyvibvsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1194.129 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[4.2.1.107-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[4.2.1.107-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=(24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qvdpwqvoskjues-jmoyvibvsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1194.129}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7243
- common-name:
- (24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa
- smiles:
- cc(ccc=c(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4c(o)c[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7))))
- inchi-key:
- qvdpwqvoskjues-jmoyvibvsa-j
- molecular-weight:
- 1194.129