Difference between revisions of "CPD-7243"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HEPARIN-GLUCOSAMINE == * common-name: ** a [heparan]-α-d-glucosamine == Reaction(s) known to consume the compound == * 2.8.2.30-R...") |
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYGLUTARATE == * common-name: ** (r)-2-hydroxyglutarate * smiles: ** c(ccc(c([o-])=o)o)([o-])=o * inchi-key: ** hwxbtnavrsuojr-g...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite R-2-HYDROXYGLUTARATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-2-hydroxyglutarate |
| + | * smiles: | ||
| + | ** c(ccc(c([o-])=o)o)([o-])=o | ||
| + | * inchi-key: | ||
| + | ** hwxbtnavrsuojr-gsvougtgsa-l | ||
| + | * molecular-weight: | ||
| + | ** 146.099 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[KETOGLUTREDUCT-RXN]] |
| − | * [[ | + | * [[RXN-14932]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[KETOGLUTREDUCT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-2-hydroxyglutarate}} |
| + | {{#set: inchi-key=inchikey=hwxbtnavrsuojr-gsvougtgsa-l}} | ||
| + | {{#set: molecular-weight=146.099}} | ||
Revision as of 14:57, 5 January 2021
Contents
Metabolite R-2-HYDROXYGLUTARATE
- common-name:
- (r)-2-hydroxyglutarate
- smiles:
- c(ccc(c([o-])=o)o)([o-])=o
- inchi-key:
- hwxbtnavrsuojr-gsvougtgsa-l
- molecular-weight:
- 146.099
