Difference between revisions of "CPD-7243"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYGLUTARATE == * common-name: ** (r)-2-hydroxyglutarate * smiles: ** c(ccc(c([o-])=o)o)([o-])=o * inchi-key: ** hwxbtnavrsuojr-g...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine746 == * common-name: ** uridine746 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11843 == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite R-2-HYDROXYGLUTARATE ==
+
== Metabolite 23S-rRNA-uridine746 ==
 
* common-name:
 
* common-name:
** (r)-2-hydroxyglutarate
+
** uridine746 in 23s rrna
* smiles:
 
** c(ccc(c([o-])=o)o)([o-])=o
 
* inchi-key:
 
** hwxbtnavrsuojr-gsvougtgsa-l
 
* molecular-weight:
 
** 146.099
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[KETOGLUTREDUCT-RXN]]
+
* [[RXN-11843]]
* [[RXN-14932]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[KETOGLUTREDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-2-hydroxyglutarate}}
+
{{#set: common-name=uridine746 in 23s rrna}}
{{#set: inchi-key=inchikey=hwxbtnavrsuojr-gsvougtgsa-l}}
 
{{#set: molecular-weight=146.099}}
 

Revision as of 13:11, 14 January 2021

Metabolite 23S-rRNA-uridine746

  • common-name:
    • uridine746 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality