Difference between revisions of "CPD-7246"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21345 == * transcription-direction: ** negative * right-end-position: ** 29857 * left-end-position: ** 21114 * centisome-position: ** 10.870002...") |
(Created page with "Category:metabolite == Metabolite CPD-7246 == * common-name: ** n-acetyl-α-d-galactosamine 1-phosphate * smiles: ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o * i...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7246 == |
| − | * | + | * common-name: |
| − | ** | + | ** n-acetyl-α-d-galactosamine 1-phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** fzljpepaypummr-jajwtyfosa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 299.174 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13760]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-13760]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=n-acetyl-α-d-galactosamine 1-phosphate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=fzljpepaypummr-jajwtyfosa-l}} |
| − | + | {{#set: molecular-weight=299.174}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7246
- common-name:
- n-acetyl-α-d-galactosamine 1-phosphate
- smiles:
- cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o
- inchi-key:
- fzljpepaypummr-jajwtyfosa-l
- molecular-weight:
- 299.174
