Difference between revisions of "CPD-7246"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BENZOYLCOA == * common-name: ** benzoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-7246 == * common-name: ** n-acetyl-α-d-galactosamine 1-phosphate * smiles: ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o * i...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7246 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-α-d-galactosamine 1-phosphate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fzljpepaypummr-jajwtyfosa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 299.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13760]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13760]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-α-d-galactosamine 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fzljpepaypummr-jajwtyfosa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=299.174}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7246
- common-name:
- n-acetyl-α-d-galactosamine 1-phosphate
- smiles:
- cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o
- inchi-key:
- fzljpepaypummr-jajwtyfosa-l
- molecular-weight:
- 299.174
