Difference between revisions of "CPD-7246"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CRPB-all-trans-Retinol == * common-name: ** an all-trans retinol-[cellular-retinol-binding-protein] == Reaction(s) known to consume the c...")
(Created page with "Category:metabolite == Metabolite CPD-7246 == * common-name: ** n-acetyl-α-d-galactosamine 1-phosphate * smiles: ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o * i...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CRPB-all-trans-Retinol ==
+
== Metabolite CPD-7246 ==
 
* common-name:
 
* common-name:
** an all-trans retinol-[cellular-retinol-binding-protein]
+
** n-acetyl-α-d-galactosamine 1-phosphate
 +
* smiles:
 +
** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o
 +
* inchi-key:
 +
** fzljpepaypummr-jajwtyfosa-l
 +
* molecular-weight:
 +
** 299.174
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12581]]
+
* [[RXN-13760]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13760]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an all-trans retinol-[cellular-retinol-binding-protein]}}
+
{{#set: common-name=n-acetyl-α-d-galactosamine 1-phosphate}}
 +
{{#set: inchi-key=inchikey=fzljpepaypummr-jajwtyfosa-l}}
 +
{{#set: molecular-weight=299.174}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-7246

  • common-name:
    • n-acetyl-α-d-galactosamine 1-phosphate
  • smiles:
    • cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o
  • inchi-key:
    • fzljpepaypummr-jajwtyfosa-l
  • molecular-weight:
    • 299.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality