Difference between revisions of "CPD-7247"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1823 == * common-name: ** nπ-methyl-l-histidine * smiles: ** cn1(c=nc=c1cc(c(=o)[o-])[n+]) * inchi-key: ** jdhildinmrgule-lurjtmie...") |
(Created page with "Category:metabolite == Metabolite CHITIN == * common-name: ** chitin == Reaction(s) known to consume the compound == * 3.2.1.14-RXN * CHITIN-DEACETYLASE-RXN * RX...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CHITIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** chitin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3.2.1.14-RXN]] | ||
| + | * [[CHITIN-DEACETYLASE-RXN]] | ||
| + | * [[RXN-12554]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=chitin}} |
| − | |||
| − | |||
Revision as of 11:14, 15 January 2021
Contents
Metabolite CHITIN
- common-name:
- chitin
