Difference between revisions of "CPD-7247"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CHITIN == * common-name: ** chitin == Reaction(s) known to consume the compound == * 3.2.1.14-RXN * CHITIN-DEACETYLASE-RXN * RX...") |
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7247 == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-13,14-dihydroretinol |
| + | * smiles: | ||
| + | ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) | ||
| + | * inchi-key: | ||
| + | ** ovboqvaiymsudt-hrygcdposa-n | ||
| + | * molecular-weight: | ||
| + | ** 288.472 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.3.99.23-RXN]] | ||
| + | * [[RETINOLSAT]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-13,14-dihydroretinol}} |
| + | {{#set: inchi-key=inchikey=ovboqvaiymsudt-hrygcdposa-n}} | ||
| + | {{#set: molecular-weight=288.472}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-7247
- common-name:
- all-trans-13,14-dihydroretinol
- smiles:
- cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)
- inchi-key:
- ovboqvaiymsudt-hrygcdposa-n
- molecular-weight:
- 288.472
