Difference between revisions of "CPD-7247"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03192 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * L-LACTATE-DEHYDROGENASE-...") |
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7247 == |
| − | + | * common-name: | |
| − | * | + | ** all-trans-13,14-dihydroretinol |
| − | == | + | * smiles: |
| − | * | + | ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** ovboqvaiymsudt-hrygcdposa-n |
| − | == | + | * molecular-weight: |
| − | + | ** 288.472 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[1.3.99.23-RXN]] | |
| − | * [[ | + | * [[RETINOLSAT]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=all-trans-13,14-dihydroretinol}} | |
| − | + | {{#set: inchi-key=inchikey=ovboqvaiymsudt-hrygcdposa-n}} | |
| − | {{#set: | + | {{#set: molecular-weight=288.472}} |
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-7247
- common-name:
- all-trans-13,14-dihydroretinol
- smiles:
- cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)
- inchi-key:
- ovboqvaiymsudt-hrygcdposa-n
- molecular-weight:
- 288.472
