Difference between revisions of "CPD-7247"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ENT-KAUR-16-EN-19-AL == * common-name: ** ent-kaurenal * smiles: ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(c=o)cccc(c)2[ch]3cc4)))) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7247 == |
* common-name: | * common-name: | ||
− | ** | + | ** all-trans-13,14-dihydroretinol |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ovboqvaiymsudt-hrygcdposa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 288.472 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[1.3.99.23-RXN]] |
+ | * [[RETINOLSAT]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=all-trans-13,14-dihydroretinol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ovboqvaiymsudt-hrygcdposa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=288.472}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-7247
- common-name:
- all-trans-13,14-dihydroretinol
- smiles:
- cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)
- inchi-key:
- ovboqvaiymsudt-hrygcdposa-n
- molecular-weight:
- 288.472