Difference between revisions of "CPD-7257"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYADENOSINE == * common-name: ** 2'-deoxyadenosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-key: ** olxzpdwkrny...") |
(Created page with "Category:metabolite == Metabolite Protein-L-serine-or-L-threonine == * common-name: ** a [protein]-(l-serine/l-threonine) == Reaction(s) known to consume the compound == *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-L-serine-or-L-threonine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-(l-serine/l-threonine) |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.4.1.109-RXN]] |
| − | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.3.16-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-(l-serine/l-threonine)}} |
| − | |||
| − | |||
Revision as of 08:27, 15 March 2021
Contents
Metabolite Protein-L-serine-or-L-threonine
- common-name:
- a [protein]-(l-serine/l-threonine)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-(l-serine/l-threonine)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
