Difference between revisions of "CPD-7257"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYADENOSINE == * common-name: ** 2'-deoxyadenosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-key: ** olxzpdwkrny...") |
(Created page with "Category:metabolite == Metabolite CPD-7257 == * common-name: ** 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl coa * smiles: ** cc(ccc(=o)c(c)c(sccnc(...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7257 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl coa |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** cc(ccc(=o)c(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4c(o)c[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** awlxqjgpnlctlm-yfxotmpnsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1210.128 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.3.1.176-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=awlxqjgpnlctlm-yfxotmpnsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1210.128}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-7257
- common-name:
- 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl coa
- smiles:
- cc(ccc(=o)c(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4c(o)c[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7))))
- inchi-key:
- awlxqjgpnlctlm-yfxotmpnsa-j
- molecular-weight:
- 1210.128
