Difference between revisions of "CPD-7257"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17018 == * transcription-direction: ** positive * right-end-position: ** 191301 * left-end-position: ** 170895 * centisome-position: ** 62.52538...")
(Created page with "Category:metabolite == Metabolite CPD-178 == * common-name: ** d-myo-inositol (3,4,5,6)-tetrakisphosphate * smiles: ** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17018 ==
+
== Metabolite CPD-178 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** d-myo-inositol (3,4,5,6)-tetrakisphosphate
−
* right-end-position:
+
* smiles:
−
** 191301
+
** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
−
* left-end-position:
+
* inchi-key:
−
** 170895
+
** mrvyfoanpdtyby-uzaagftcsa-f
−
* centisome-position:
+
* molecular-weight:
−
** 62.52538   
+
** 492.013
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.7.1.134-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[DIHYDROFOLATESYNTH-RXN]]
+
{{#set: common-name=d-myo-inositol (3,4,5,6)-tetrakisphosphate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=mrvyfoanpdtyby-uzaagftcsa-f}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=492.013}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[FORMYLTHFGLUSYNTH-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-6341]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-2921]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6614]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-2161]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=191301}}
 
−
{{#set: left-end-position=170895}}
 
−
{{#set: centisome-position=62.52538    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-178

  • common-name:
    • d-myo-inositol (3,4,5,6)-tetrakisphosphate
  • smiles:
    • c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • mrvyfoanpdtyby-uzaagftcsa-f
  • molecular-weight:
    • 492.013

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7257&oldid=46913"