Difference between revisions of "CPD-7257"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite QUINATE == * common-name: ** l-quinate * smiles: ** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1) * inchi-key: ** aawzdtnxlsgcek-wywmibkrsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite Proteins-With-N-Terminal-Asp == * common-name: ** an n-terminal l-aspartyl-[protein] == Reaction(s) known to consume the compound == * ...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Proteins-With-N-Terminal-Asp == |
* common-name: | * common-name: | ||
− | ** l- | + | ** an n-terminal l-aspartyl-[protein] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17889]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=l- | + | {{#set: common-name=an n-terminal l-aspartyl-[protein]}} |
− | |||
− |
Revision as of 15:27, 5 January 2021
Contents
Metabolite Proteins-With-N-Terminal-Asp
- common-name:
- an n-terminal l-aspartyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal l-aspartyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.