Difference between revisions of "CPD-7279"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7864 RXN-7864] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/2.3.1...") |
(Created page with "Category:metabolite == Metabolite CPD-7279 == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o * inchi-key: ** ztalkmxohwqnia-t...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7279 == |
| − | * | + | * common-name: |
| − | ** | + | ** 2-cis,4-trans-xanthoxin |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o |
| − | = | + | * inchi-key: |
| − | + | ** ztalkmxohwqnia-tvbshjcbsa-n | |
| − | + | * molecular-weight: | |
| − | * | + | ** 250.337 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[1.1.1.288-RXN]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-698]] | |
| − | * | + | * [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=2-cis,4-trans-xanthoxin}} |
| − | * | + | {{#set: inchi-key=inchikey=ztalkmxohwqnia-tvbshjcbsa-n}} |
| − | + | {{#set: molecular-weight=250.337}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7279
- common-name:
- 2-cis,4-trans-xanthoxin
- smiles:
- cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
- inchi-key:
- ztalkmxohwqnia-tvbshjcbsa-n
- molecular-weight:
- 250.337
