Difference between revisions of "CPD-7279"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.18.1.2-RXN 1.18.1.2-RXN] == * direction: ** reversible * common-name: ** ferredoxin nadp reductas...")
(Created page with "Category:metabolite == Metabolite CPD-7279 == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o * inchi-key: ** ztalkmxohwqnia-t...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.18.1.2-RXN 1.18.1.2-RXN] ==
+
== Metabolite CPD-7279 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** ferredoxin nadp reductase
+
** 2-cis,4-trans-xanthoxin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.18.1.2 ec-1.18.1.2]
+
** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][e] '''<=>''' 1 [[NADPH]][c] '''+''' 2 [[Oxidized-ferredoxins]][e]
+
** ztalkmxohwqnia-tvbshjcbsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09107]]
+
** 250.337
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[1.1.1.288-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-698]]
−
* Gene: [[SJ15967]]
+
* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=2-cis,4-trans-xanthoxin}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=ztalkmxohwqnia-tvbshjcbsa-n}}
−
* [[PWY-101]], photosynthesis light reactions: [http://metacyc.org/META/NEW-IMAGE?object=PWY-101 PWY-101]
+
{{#set: molecular-weight=250.337}}
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01195 R01195]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=ferredoxin nadp reductase}}
 
−
{{#set: ec-number=ec-1.18.1.2}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-7279

  • common-name:
    • 2-cis,4-trans-xanthoxin
  • smiles:
    • cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
  • inchi-key:
    • ztalkmxohwqnia-tvbshjcbsa-n
  • molecular-weight:
    • 250.337

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7279&oldid=138772"