Difference between revisions of "CPD-728"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * common-name: ** 4-hydroxybenzoate * smiles: ** c(c1(c=cc(=cc=1)o))(=o)[o-] * inchi-key: ** fjkrolugyxjwqn-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite CPD-728 == * common-name: ** (9z,13s,15z)-12,13-epoxyoctadeca-9,11,15-trienoate * smiles: ** ccc=cc[ch]1(oc1=cc=ccccccccc(=o)[o-]) * inch...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-728 == |
* common-name: | * common-name: | ||
− | ** | + | ** (9z,13s,15z)-12,13-epoxyoctadeca-9,11,15-trienoate |
* smiles: | * smiles: | ||
− | ** | + | ** ccc=cc[ch]1(oc1=cc=ccccccccc(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yzbzoruzosczrn-dcupsmfcsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 291.409 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN1F-19]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(9z,13s,15z)-12,13-epoxyoctadeca-9,11,15-trienoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yzbzoruzosczrn-dcupsmfcsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=291.409}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-728
- common-name:
- (9z,13s,15z)-12,13-epoxyoctadeca-9,11,15-trienoate
- smiles:
- ccc=cc[ch]1(oc1=cc=ccccccccc(=o)[o-])
- inchi-key:
- yzbzoruzosczrn-dcupsmfcsa-m
- molecular-weight:
- 291.409