Difference between revisions of "CPD-7280"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13081 == * common-name: ** solasodine 3-o-β-d-glucoside * smiles: ** cc1(cnc2(cc1)(c(c)c3([ch](o2)cc4(c(c)3cc[ch]5([ch]4cc=c7(c(...")
(Created page with "Category:metabolite == Metabolite CPD-15364 == * common-name: ** ricinoleoyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13081 ==
+
== Metabolite CPD-15364 ==
 
* common-name:
 
* common-name:
** solasodine 3-o-β-d-glucoside
+
** ricinoleoyl-coa
 
* smiles:
 
* smiles:
** cc1(cnc2(cc1)(c(c)c3([ch](o2)cc4(c(c)3cc[ch]5([ch]4cc=c7(c(c)5ccc(oc6(oc(co)c(o)c(o)c(o)6))c7))))))
+
** ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** xmlljghzphtukk-kjnrmupvsa-n
+
** bhvzcckrrpyxcv-mgnvxpimsa-j
 
* molecular-weight:
 
* molecular-weight:
** 575.784
+
** 1043.952
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14492]]
 +
* [[RXN-16151]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12123]]
+
* [[RXN-16151]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=solasodine 3-o-β-d-glucoside}}
+
{{#set: common-name=ricinoleoyl-coa}}
{{#set: inchi-key=inchikey=xmlljghzphtukk-kjnrmupvsa-n}}
+
{{#set: inchi-key=inchikey=bhvzcckrrpyxcv-mgnvxpimsa-j}}
{{#set: molecular-weight=575.784}}
+
{{#set: molecular-weight=1043.952}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-15364

  • common-name:
    • ricinoleoyl-coa
  • smiles:
    • ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • bhvzcckrrpyxcv-mgnvxpimsa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality