Difference between revisions of "CPD-7285"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NOREPINEPHRINE == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=cc=1c(c[n+])o)o) * inchi-key: ** sflshlfxelfnjz-qmmmgpobsa...") |
(Created page with "Category:metabolite == Metabolite CPD-7285 == * common-name: ** 25-hydroxycholesterol * smiles: ** cc(cccc(o)(c)c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7285 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 25-hydroxycholesterol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(cccc(o)(c)c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** inbgsxnnrgwlju-zhhjotbysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 402.659 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.14.99.38-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=25-hydroxycholesterol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=inbgsxnnrgwlju-zhhjotbysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=402.659}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-7285
- common-name:
- 25-hydroxycholesterol
- smiles:
- cc(cccc(o)(c)c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- inbgsxnnrgwlju-zhhjotbysa-n
- molecular-weight:
- 402.659
