Difference between revisions of "CPD-729"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01598 == * transcription-direction: ** positive * right-end-position: ** 86227 * left-end-position: ** 62172 * centisome-position: ** 42.02571...")
(Created page with "Category:metabolite == Metabolite CPD-729 == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) * inchi-key: ** pmtmafapl...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ01598 ==
+
== Metabolite CPD-729 ==
* transcription-direction:
+
* common-name:
** positive
+
** 12-oxo-cis-10,15-phytodienoate
* right-end-position:
+
* smiles:
** 86227
+
** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o)
* left-end-position:
+
* inchi-key:
** 62172
+
** pmtmafaplcgxgk-jmtmcxqrsa-m
* centisome-position:
+
* molecular-weight:
** 42.02571   
+
** 291.409
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[2.7.10.1-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=12-oxo-cis-10,15-phytodienoate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=pmtmafaplcgxgk-jmtmcxqrsa-m}}
* [[2.7.12.1-RXN]]
+
{{#set: molecular-weight=291.409}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[PROTEIN-KINASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-14906]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-8443]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-5381]]
 
** '''6''' reactions found over '''11''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=86227}}
 
{{#set: left-end-position=62172}}
 
{{#set: centisome-position=42.02571    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=5}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-729

  • common-name:
    • 12-oxo-cis-10,15-phytodienoate
  • smiles:
    • ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o)
  • inchi-key:
    • pmtmafaplcgxgk-jmtmcxqrsa-m
  • molecular-weight:
    • 291.409

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality