Difference between revisions of "CPD-734"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...")
(Created page with "Category:metabolite == Metabolite CPD-734 == * common-name: ** (-)-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-])=o) * inchi-key: ** znjfbwydhiglcu-hwkxxfmvsa-m * molec...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-TP ==
+
== Metabolite CPD-734 ==
 
* common-name:
 
* common-name:
** pppgpp
+
** (-)-jasmonate
 
* smiles:
 
* smiles:
** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** ccc=ccc1(c(=o)ccc1cc([o-])=o)
 
* inchi-key:
 
* inchi-key:
** kcpmacxzaitqax-uuokfmhzsa-h
+
** znjfbwydhiglcu-hwkxxfmvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 677.095
+
** 209.264
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6427]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GTPPYPHOSKIN-RXN]]
+
* [[RXN-10767]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pppgpp}}
+
{{#set: common-name=(-)-jasmonate}}
{{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}}
+
{{#set: inchi-key=inchikey=znjfbwydhiglcu-hwkxxfmvsa-m}}
{{#set: molecular-weight=677.095}}
+
{{#set: molecular-weight=209.264}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-734

  • common-name:
    • (-)-jasmonate
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc([o-])=o)
  • inchi-key:
    • znjfbwydhiglcu-hwkxxfmvsa-m
  • molecular-weight:
    • 209.264

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality