Difference between revisions of "CPD-734"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00758 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-6883 ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-734 == * common-name: ** (-)-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-])=o) * inchi-key: ** znjfbwydhiglcu-hwkxxfmvsa-m * molec...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-734 == |
| − | + | * common-name: | |
| − | * | + | ** (-)-jasmonate |
| − | == | + | * smiles: |
| − | * | + | ** ccc=ccc1(c(=o)ccc1cc([o-])=o) |
| − | ** | + | * inchi-key: |
| − | ** | + | ** znjfbwydhiglcu-hwkxxfmvsa-m |
| − | == | + | * molecular-weight: |
| − | * [[ | + | ** 209.264 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[RXN-10767]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| + | {{#set: common-name=(-)-jasmonate}} | ||
| + | {{#set: inchi-key=inchikey=znjfbwydhiglcu-hwkxxfmvsa-m}} | ||
| + | {{#set: molecular-weight=209.264}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-734
- common-name:
- (-)-jasmonate
- smiles:
- ccc=ccc1(c(=o)ccc1cc([o-])=o)
- inchi-key:
- znjfbwydhiglcu-hwkxxfmvsa-m
- molecular-weight:
- 209.264
