Difference between revisions of "CPD-734"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...")
(Created page with "Category:metabolite == Metabolite CPD0-2253 == * common-name: ** (s)-3-hydroxy-stearoyl-coa * smiles: ** cccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-TP ==
+
== Metabolite CPD0-2253 ==
 
* common-name:
 
* common-name:
** pppgpp
+
** (s)-3-hydroxy-stearoyl-coa
 
* smiles:
 
* smiles:
** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** cccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** kcpmacxzaitqax-uuokfmhzsa-h
+
** wzmaiegyxcoysh-sfkgbvsgsa-j
 
* molecular-weight:
 
* molecular-weight:
** 677.095
+
** 1045.968
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6427]]
+
* [[ECOAH8]]
 +
* [[ECOAH8h]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GTPPYPHOSKIN-RXN]]
+
* [[ECOAH8h]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pppgpp}}
+
{{#set: common-name=(s)-3-hydroxy-stearoyl-coa}}
{{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}}
+
{{#set: inchi-key=inchikey=wzmaiegyxcoysh-sfkgbvsgsa-j}}
{{#set: molecular-weight=677.095}}
+
{{#set: molecular-weight=1045.968}}

Revision as of 15:25, 5 January 2021

Metabolite CPD0-2253

  • common-name:
    • (s)-3-hydroxy-stearoyl-coa
  • smiles:
    • cccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • wzmaiegyxcoysh-sfkgbvsgsa-j
  • molecular-weight:
    • 1045.968

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality