Difference between revisions of "CPD-7367"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17324 == * common-name: ** 3-oxo adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
(Created page with "Category:metabolite == Metabolite CPD-19013 == * common-name: ** 2-methylpropane-1,2-diol * smiles: ** cc(o)(c)co * inchi-key: ** btvwzwfkmiusgs-uhfffaoysa-n * molecular-w...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17324 ==
+
== Metabolite CPD-19013 ==
 
* common-name:
 
* common-name:
** 3-oxo adrenoyl-coa
+
** 2-methylpropane-1,2-diol
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(o)(c)co
 
* inchi-key:
 
* inchi-key:
** vmajwsswcpbijy-kpovblhlsa-j
+
** btvwzwfkmiusgs-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1091.996
+
** 90.122
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16112]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17589]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo adrenoyl-coa}}
+
{{#set: common-name=2-methylpropane-1,2-diol}}
{{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}}
+
{{#set: inchi-key=inchikey=btvwzwfkmiusgs-uhfffaoysa-n}}
{{#set: molecular-weight=1091.996}}
+
{{#set: molecular-weight=90.122}}

Revision as of 08:24, 15 March 2021

Metabolite CPD-19013

  • common-name:
    • 2-methylpropane-1,2-diol
  • smiles:
    • cc(o)(c)co
  • inchi-key:
    • btvwzwfkmiusgs-uhfffaoysa-n
  • molecular-weight:
    • 90.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality