Difference between revisions of "CPD-7367"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-...") |
(Created page with "Category:metabolite == Metabolite CPD-19491 == * common-name: ** 3-isopropyl-6-(methylthio)-2-oxohexanoate * smiles: ** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-] * inchi-key: ** w...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19491 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-isopropyl-6-(methylthio)-2-oxohexanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wrgktdwhjsbcjr-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 218.224 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-18208]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-18208]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-isopropyl-6-(methylthio)-2-oxohexanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wrgktdwhjsbcjr-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=218.224}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-19491
- common-name:
- 3-isopropyl-6-(methylthio)-2-oxohexanoate
- smiles:
- c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-]
- inchi-key:
- wrgktdwhjsbcjr-uhfffaoysa-l
- molecular-weight:
- 218.224
