Difference between revisions of "CPD-7367"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19491 == * common-name: ** 3-isopropyl-6-(methylthio)-2-oxohexanoate * smiles: ** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-] * inchi-key: ** w...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-PROPIONATE == * common-name: ** 3-hydroxypropanoate * smiles: ** c(co)c([o-])=o * inchi-key: ** alrhlsyjtwahjz-uhfffaoysa-m * m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-HYDROXY-PROPIONATE == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** 3-hydroxypropanoate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(co)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** alrhlsyjtwahjz-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 89.071 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[HICH]] |
| + | * [[RXN-6384]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=3-hydroxypropanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=alrhlsyjtwahjz-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=89.071}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite 3-HYDROXY-PROPIONATE
- common-name:
- 3-hydroxypropanoate
- smiles:
- c(co)c([o-])=o
- inchi-key:
- alrhlsyjtwahjz-uhfffaoysa-m
- molecular-weight:
- 89.071
