Difference between revisions of "CPD-7409"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-alanine == * common-name: ** an n-terminal l-alanyl-[protein] == Reaction(s) known to consume the compound == == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-7409 == * common-name: ** β-cryptoxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7409 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-cryptoxanthin |
| + | * smiles: | ||
| + | ** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c | ||
| + | * inchi-key: | ||
| + | ** dmaslkhvqrhnes-fkkupvfpsa-n | ||
| + | * molecular-weight: | ||
| + | ** 552.882 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8026]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8025]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-cryptoxanthin}} |
| + | {{#set: inchi-key=inchikey=dmaslkhvqrhnes-fkkupvfpsa-n}} | ||
| + | {{#set: molecular-weight=552.882}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-7409
- common-name:
- β-cryptoxanthin
- smiles:
- cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c
- inchi-key:
- dmaslkhvqrhnes-fkkupvfpsa-n
- molecular-weight:
- 552.882
