Difference between revisions of "CPD-7417"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11512 == * common-name: ** a (2r,3s,4s)-leucoanthocyanidin == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o * inc...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-7417 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cis-coumarinic acid-β-d-glucoside |
| + | * smiles: | ||
| + | ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o | ||
| + | * inchi-key: | ||
| + | ** gvriyimnjgulcz-qlfwqtqqsa-m | ||
| + | * molecular-weight: | ||
| + | ** 325.294 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8036]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cis-coumarinic acid-β-d-glucoside}} |
| + | {{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}} | ||
| + | {{#set: molecular-weight=325.294}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7417
- common-name:
- cis-coumarinic acid-β-d-glucoside
- smiles:
- c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
- inchi-key:
- gvriyimnjgulcz-qlfwqtqqsa-m
- molecular-weight:
- 325.294
