Difference between revisions of "CPD-7417"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTDPDEHYDRHAMEPIM-RXN DTDPDEHYDRHAMEPIM-RXN] == * direction: ** left-to-right * common-name: ** dtd...")
 
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o * inc...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTDPDEHYDRHAMEPIM-RXN DTDPDEHYDRHAMEPIM-RXN] ==
+
== Metabolite CPD-7417 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** dtdp-4-dehydrorhamnose 3,5-epimerase
+
** cis-coumarinic acid-β-d-glucoside
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/5.1.3.13 ec-5.1.3.13]
+
** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[DTDP-DEOH-DEOXY-GLUCOSE]][c] '''=>''' 1 [[DTDP-DEOH-DEOXY-MANNOSE]][c]
+
** gvriyimnjgulcz-qlfwqtqqsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ22556]]
+
** 325.294
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-8036]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[DTDPRHAMSYN-PWY]], dTDP-L-rhamnose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=DTDPRHAMSYN-PWY DTDPRHAMSYN-PWY]
+
== Reaction(s) of unknown directionality ==
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=cis-coumarinic acid-β-d-glucoside}}
−
* [[PWY-7301]], dTDP-4-O-demethyl-β-L-noviose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7301 PWY-7301]
+
{{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}}
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
{{#set: molecular-weight=325.294}}
−
* [[PWY-7814]], dTDP-L-daunosamine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7814 PWY-7814]
 
−
** '''2''' reactions found over '''6''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16969 16969]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R06514 R06514]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q9JWX1 Q9JWX1]
 
−
** [http://www.uniprot.org/uniprot/Q9JWW7 Q9JWW7]
 
−
** [http://www.uniprot.org/uniprot/Q9UZG9 Q9UZG9]
 
−
** [http://www.uniprot.org/uniprot/P37745 P37745]
 
−
** [http://www.uniprot.org/uniprot/Q7M0V5 Q7M0V5]
 
−
** [http://www.uniprot.org/uniprot/P37763 P37763]
 
−
** [http://www.uniprot.org/uniprot/Q46770 Q46770]
 
−
** [http://www.uniprot.org/uniprot/P29783 P29783]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=dtdp-4-dehydrorhamnose 3,5-epimerase}}
 
−
{{#set: ec-number=ec-5.1.3.13}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-7417

  • common-name:
    • cis-coumarinic acid-β-d-glucoside
  • smiles:
    • c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
  • inchi-key:
    • gvriyimnjgulcz-qlfwqtqqsa-m
  • molecular-weight:
    • 325.294

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7417&oldid=138717"