Difference between revisions of "CPD-7417"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OXIDIZED-GLUTATHIONE == * common-name: ** glutathione disulfide * smiles: ** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-...") |
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o * inc...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7417 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cis-coumarinic acid-β-d-glucoside |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gvriyimnjgulcz-qlfwqtqqsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 325.294 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8036]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cis-coumarinic acid-β-d-glucoside}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=325.294}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7417
- common-name:
- cis-coumarinic acid-β-d-glucoside
- smiles:
- c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
- inchi-key:
- gvriyimnjgulcz-qlfwqtqqsa-m
- molecular-weight:
- 325.294
