Difference between revisions of "CPD-7417"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GPPS GPPS] == * direction: ** left-to-right * common-name: ** geranyl pyrophosphate synthase == Rea...") |
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o * inc...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7417 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** cis-coumarinic acid-β-d-glucoside |
| − | == | + | * smiles: |
| − | + | ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o | |
| − | + | * inchi-key: | |
| − | * | + | ** gvriyimnjgulcz-qlfwqtqqsa-m |
| − | ** | + | * molecular-weight: |
| − | ** | + | ** 325.294 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-8036]] | |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=cis-coumarinic acid-β-d-glucoside}} | |
| − | {{#set: common-name= | + | {{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}} |
| − | {{#set: | + | {{#set: molecular-weight=325.294}} |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7417
- common-name:
- cis-coumarinic acid-β-d-glucoside
- smiles:
- c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
- inchi-key:
- gvriyimnjgulcz-qlfwqtqqsa-m
- molecular-weight:
- 325.294
