Difference between revisions of "CPD-7418"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14545 == * transcription-direction: ** positive * right-end-position: ** 79823 * left-end-position: ** 65683 * centisome-position: ** 9.216894...")
(Created page with "Category:metabolite == Metabolite CPD-7418 == * common-name: ** coumarinate * smiles: ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-] * inchi-key: ** pmowtihvnwzyfi-waywqwqtsa-m * molec...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ14545 ==
+
== Metabolite CPD-7418 ==
* transcription-direction:
+
* common-name:
** positive
+
** coumarinate
* right-end-position:
+
* smiles:
** 79823
+
** c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
* left-end-position:
+
* inchi-key:
** 65683
+
** pmowtihvnwzyfi-waywqwqtsa-m
* centisome-position:
+
* molecular-weight:
** 9.216894   
+
** 163.152
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-8036]]
* [[PHOSMANMUT-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=coumarinate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=pmowtihvnwzyfi-waywqwqtsa-m}}
** Category: [[orthology]]
+
{{#set: molecular-weight=163.152}}
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-5659]]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7456]]
 
** '''2''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7586]]
 
** '''2''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-882]]
 
** '''6''' reactions found over '''8''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=79823}}
 
{{#set: left-end-position=65683}}
 
{{#set: centisome-position=9.216894    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-7418

  • common-name:
    • coumarinate
  • smiles:
    • c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
  • inchi-key:
    • pmowtihvnwzyfi-waywqwqtsa-m
  • molecular-weight:
    • 163.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality