Difference between revisions of "CPD-7418"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 25S-rRNA-N1-methyladenine-645 == * common-name: ** n1-methyladenine645 in 25s rrna == Reaction(s) known to consume the compound == == Rea...") |
(Created page with "Category:metabolite == Metabolite CPD-7418 == * common-name: ** coumarinate * smiles: ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-] * inchi-key: ** pmowtihvnwzyfi-waywqwqtsa-m * molec...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7418 == |
* common-name: | * common-name: | ||
| − | ** | + | ** coumarinate |
| + | * smiles: | ||
| + | ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** pmowtihvnwzyfi-waywqwqtsa-m | ||
| + | * molecular-weight: | ||
| + | ** 163.152 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8036]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=coumarinate}} |
| + | {{#set: inchi-key=inchikey=pmowtihvnwzyfi-waywqwqtsa-m}} | ||
| + | {{#set: molecular-weight=163.152}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-7418
- common-name:
- coumarinate
- smiles:
- c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
- inchi-key:
- pmowtihvnwzyfi-waywqwqtsa-m
- molecular-weight:
- 163.152
