|
|
| (7 intermediate revisions by 2 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ10585 == | + | == Metabolite CPD-7524 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** 7,9,9'-cis-neurosporene |
| − | * right-end-position:
| + | * smiles: |
| − | ** 137833 | + | ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 130711 | + | ** atcicvfrsjqydv-ifjqppewsa-n |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 33.678333
| + | ** 538.898 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[RXN-11357]] |
| − | == Reaction(s) associated == | + | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[RXN-11356]] |
| − | * [[3.1.1.64-RXN]] | + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=7,9,9'-cis-neurosporene}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | + | {{#set: inchi-key=inchikey=atcicvfrsjqydv-ifjqppewsa-n}} |
| − | * [[6PGLUCONOLACT-RXN]]
| + | {{#set: molecular-weight=538.898}} |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[CARBOXYLESTERASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RETINYL-PALMITATE-ESTERASE-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-10711]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10767]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-12252]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-12575]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXNQT-4366]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[GLYCOLYSIS-E-D]]
| |
| − | ** '''4''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[OXIDATIVEPENT-PWY]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[RUMP-PWY]]
| |
| − | ** '''4''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[P122-PWY]]
| |
| − | ** '''16''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY-6303]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-6857]]
| |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=137833}} | |
| − | {{#set: left-end-position=130711}}
| |
| − | {{#set: centisome-position=33.678333 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=9}}
| |
| − | {{#set: nb pathway associated=6}}
| |
