Difference between revisions of "CPD-7524"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10585 == * transcription-direction: ** positive * right-end-position: ** 137833 * left-end-position: ** 130711 * centisome-position: ** 33.678333...") |
(Created page with "Category:metabolite == Metabolite CPD-7524 == * common-name: ** 7,9,9'-cis-neurosporene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c *...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-7524 == |
− | * | + | * common-name: |
− | ** | + | ** 7,9,9'-cis-neurosporene |
− | + | * smiles: | |
− | * | + | ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c |
− | + | * inchi-key: | |
− | ** | + | ** atcicvfrsjqydv-ifjqppewsa-n |
− | + | * molecular-weight: | |
− | + | ** 538.898 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11357]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-11356]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=7,9,9'-cis-neurosporene}} | |
− | ** | + | {{#set: inchi-key=inchikey=atcicvfrsjqydv-ifjqppewsa-n}} |
− | + | {{#set: molecular-weight=538.898}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-7524
- common-name:
- 7,9,9'-cis-neurosporene
- smiles:
- cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- atcicvfrsjqydv-ifjqppewsa-n
- molecular-weight:
- 538.898