Difference between revisions of "CPD-7526"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-glucopyranose-6-phosphate == * common-name: ** d-glucopyranose 6-phosphate == Reaction(s) known to consume the compound == * GLU6PDEH...")
(Created page with "Category:metabolite == Metabolite CPD-7526 == * common-name: ** 9,9'-di-cis-ζ-carotene * smiles: ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-glucopyranose-6-phosphate ==
+
== Metabolite CPD-7526 ==
 
* common-name:
 
* common-name:
** d-glucopyranose 6-phosphate
+
** 9,9'-di-cis-ζ-carotene
 +
* smiles:
 +
** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
 +
* inchi-key:
 +
** biwlelkafxrpde-zurblsrnsa-n
 +
* molecular-weight:
 +
** 540.914
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLU6PDEHYDROG-RXN]]
+
* [[RXN-11354]]
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+
* [[RXN-11356]]
* [[PGLUCISOM-RXN]]
+
* [[RXN-12242]]
* [[PHOSPHOGLUCMUT-RXN]]
 
* [[RXN-14819]]
 
* [[RXN66-526]]
 
* [[TREHALOSE6PSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUCOKIN-RXN]]
+
* [[RXN-11354]]
* [[PGLUCISOM-RXN]]
 
* [[PHOSPHOGLUCMUT-RXN]]
 
* [[RXN-14819]]
 
* [[RXN-16998]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glucopyranose 6-phosphate}}
+
{{#set: common-name=9,9'-di-cis-ζ-carotene}}
 +
{{#set: inchi-key=inchikey=biwlelkafxrpde-zurblsrnsa-n}}
 +
{{#set: molecular-weight=540.914}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-7526

  • common-name:
    • 9,9'-di-cis-ζ-carotene
  • smiles:
    • cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
  • inchi-key:
    • biwlelkafxrpde-zurblsrnsa-n
  • molecular-weight:
    • 540.914

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality