Difference between revisions of "CPD-7526"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12380 RXN-12380] == * direction: ** left-to-right * common-name: ** trna (guanine27-n2-methyltr...")
(Created page with "Category:metabolite == Metabolite CDP-ETHANOLAMINE == * common-name: ** cdp-ethanolamine * smiles: ** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12380 RXN-12380] ==
+
== Metabolite CDP-ETHANOLAMINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trna (guanine27-n2-methyltransferase
+
** cdp-ethanolamine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.215 ec-2.1.1.215]
+
** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[tRNA-Containing-N2-Dimethylgua-26-Gua27]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[tRNA-Containing-N2-Dimetgua-26-MeGua27]][c]
+
** wvimueuqjfpndk-pebgctimsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ14807]]
+
** 445.239
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
−
* Gene: [[SJ09381]]
+
* [[RXN-17731]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.7.7.14-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=cdp-ethanolamine}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}}
−
== External links  ==
+
{{#set: molecular-weight=445.239}}
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=43137 43137]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=trna (guanine27-n2-methyltransferase}}
 
−
{{#set: ec-number=ec-2.1.1.215}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CDP-ETHANOLAMINE

  • common-name:
    • cdp-ethanolamine
  • smiles:
    • c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
  • inchi-key:
    • wvimueuqjfpndk-pebgctimsa-m
  • molecular-weight:
    • 445.239

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7526&oldid=47773"