Difference between revisions of "CPD-7598"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17387 == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc...")
(Created page with "Category:metabolite == Metabolite CPD-7598 == * common-name: ** anandamide * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)ncco * inchi-key: ** lgeqqwmqcriykg-dofzraljsa-n * mole...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17387 ==
+
== Metabolite CPD-7598 ==
 
* common-name:
 
* common-name:
** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** anandamide
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cccccc=ccc=ccc=ccc=ccccc(=o)ncco
 
* inchi-key:
 
* inchi-key:
** jjcguwrdulvwqg-drxnpijbsa-j
+
** lgeqqwmqcriykg-dofzraljsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1118.034
+
** 347.54
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN6666-2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16135]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=anandamide}}
{{#set: inchi-key=inchikey=jjcguwrdulvwqg-drxnpijbsa-j}}
+
{{#set: inchi-key=inchikey=lgeqqwmqcriykg-dofzraljsa-n}}
{{#set: molecular-weight=1118.034}}
+
{{#set: molecular-weight=347.54}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-7598

  • common-name:
    • anandamide
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccc(=o)ncco
  • inchi-key:
    • lgeqqwmqcriykg-dofzraljsa-n
  • molecular-weight:
    • 347.54

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality