|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ18471 == | + | == Metabolite CPD-7598 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** anandamide |
| − | * right-end-position: | + | * smiles: |
| − | ** 230453 | + | ** cccccc=ccc=ccc=ccc=ccccc(=o)ncco |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 211671 | + | ** lgeqqwmqcriykg-dofzraljsa-n |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 86.64885 | + | ** 347.54 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]] | + | * [[RXN6666-2]] |
| − | == Reaction(s) associated == | + | == Reaction(s) known to produce the compound == |
| − | * [[ACONITATEDEHYDR-RXN]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=anandamide}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: inchi-key=inchikey=lgeqqwmqcriykg-dofzraljsa-n}} |
| − | ** Category: [[orthology]]
| + | {{#set: molecular-weight=347.54}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[ACONITATEHYDR-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-14047]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[TCA]]
| |
| − | ** '''9''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-6549]]
| |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-5392]]
| |
| − | ** '''6''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-5690]]
| |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[P105-PWY]]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[REDCITCYC]]
| |
| − | ** '''5''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY66-398]]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-7254]]
| |
| − | ** '''7''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-6969]]
| |
| − | ** '''10''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[FERMENTATION-PWY]]
| |
| − | ** '''11''' reactions found over '''16''' reactions in the full pathway
| |
| − | * [[GLYOXYLATE-BYPASS]]
| |
| − | ** '''6''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-5750]]
| |
| − | ** '''3''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5913]]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[P23-PWY]]
| |
| − | ** '''9''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-7124]]
| |
| − | ** '''8''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-6728]]
| |
| − | ** '''11''' reactions found over '''19''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=230453}} | |
| − | {{#set: left-end-position=211671}}
| |
| − | {{#set: centisome-position=86.64885 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=3}}
| |
| − | {{#set: nb pathway associated=16}}
| |
