Difference between revisions of "CPD-763"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite CPD-763 == * common-name: ** arsenite * smiles: ** [as](o)([o-])o * inchi-key: ** aqlmhyswfmlwbs-uhfffaoysa-n * molecular-weight: ** 124....")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SUC-COA ==
+
== Metabolite CPD-763 ==
 
* common-name:
 
* common-name:
** succinyl-coa
+
** arsenite
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** [as](o)([o-])o
 
* inchi-key:
 
* inchi-key:
** vnoyujkhfwywir-itiydsspsa-i
+
** aqlmhyswfmlwbs-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 862.568
+
** 124.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AKGDHe2r]]
+
* [[2.1.1.137-RXN]]
* [[HOMSUCTRAN-RXN]]
+
* [[3.6.3.16-RXN]]
* [[RXN0-1147]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2OXOGLUTARATEDEH-RXN]]
+
* [[3.6.3.16-RXN]]
* [[AKGDHe2r]]
+
* [[RXN-982]]
* [[RXN0-1147]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=succinyl-coa}}
+
{{#set: common-name=arsenite}}
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
+
{{#set: inchi-key=inchikey=aqlmhyswfmlwbs-uhfffaoysa-n}}
{{#set: molecular-weight=862.568}}
+
{{#set: molecular-weight=124.936}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-763

  • common-name:
    • arsenite
  • smiles:
    • [as](o)([o-])o
  • inchi-key:
    • aqlmhyswfmlwbs-uhfffaoysa-n
  • molecular-weight:
    • 124.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality