|
|
| (8 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=S-2-HYDROXY-ACID-OXIDASE-RXN S-2-HYDROXY-ACID-OXIDASE-RXN] == | + | == Metabolite CPD-7649 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** (s)-2-hydroxy-acid oxidase | + | ** dopamine 3-o-sulfate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/1.1.3.15 ec-1.1.3.15] | + | ** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[S-2-Hydroxyacids1]][c] '''=>''' 1 [[2-Oxo-carboxylates]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
| + | ** nzkryjgnypyxjz-uhfffaoysa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 233.239 |
| − | * Gene: [[SJ22039]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[RXN6666-9]] |
| − | * Gene: [[SJ20716]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=dopamine 3-o-sulfate}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | {{#set: inchi-key=inchikey=nzkryjgnypyxjz-uhfffaoysa-n}} |
| − | ** Category: [[orthology]]
| + | {{#set: molecular-weight=233.239}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ17283]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ06498]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ21294]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16789 16789]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01341 R01341]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P05414 P05414]
| |
| − | ** [http://www.uniprot.org/uniprot/Q07523 Q07523]
| |
| − | ** [http://www.uniprot.org/uniprot/P72842 P72842]
| |
| − | ** [http://www.uniprot.org/uniprot/P73119 P73119]
| |
| − | ** [http://www.uniprot.org/uniprot/O22544 O22544]
| |
| − | ** [http://www.uniprot.org/uniprot/O82077 O82077]
| |
| − | ** [http://www.uniprot.org/uniprot/O49506 O49506]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43775 Q43775]
| |
| − | ** [http://www.uniprot.org/uniprot/O81692 O81692]
| |
| − | ** [http://www.uniprot.org/uniprot/O52792 O52792]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=(s)-2-hydroxy-acid oxidase}} | |
| − | {{#set: ec-number=ec-1.1.3.15}} | |
| − | {{#set: nb gene associated=5}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
| |
