Difference between revisions of "CPD-7649"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9659 RXN-9659] == * direction: ** left-to-right * common-name: ** trans oct-2-enoyl-[acp] reduc...")
(Created page with "Category:metabolite == Metabolite CPD-7649 == * common-name: ** dopamine 3-o-sulfate * smiles: ** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1) * inchi-key: ** nzkryjgnypyxjz-u...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9659 RXN-9659] ==
+
== Metabolite CPD-7649 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trans oct-2-enoyl-[acp] reductase
+
** dopamine 3-o-sulfate
−
** octanoyl-[acyl-carrier-protein] reductase
+
* smiles:
−
* ec-number:
+
** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
−
** [http://enzyme.expasy.org/EC/1.3.1.9 ec-1.3.1.9]
+
* inchi-key:
−
== Reaction formula ==
+
** nzkryjgnypyxjz-uhfffaoysa-n
−
* 1 [[2-Octenoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Octanoyl-ACPs]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 233.239
−
* Gene: [[SJ03883]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN6666-9]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=dopamine 3-o-sulfate}}
−
* Gene: [[SJ00320]]
+
{{#set: inchi-key=inchikey=nzkryjgnypyxjz-uhfffaoysa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=233.239}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 
−
** '''31''' reactions found over '''31''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=trans oct-2-enoyl-[acp] reductase|octanoyl-[acyl-carrier-protein] reductase}}
 
−
{{#set: ec-number=ec-1.3.1.9}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-7649

  • common-name:
    • dopamine 3-o-sulfate
  • smiles:
    • c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
  • inchi-key:
    • nzkryjgnypyxjz-uhfffaoysa-n
  • molecular-weight:
    • 233.239

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7649&oldid=138650"